C11H14N4Na2O8S2 — CID 172919093
disodium;2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-[(2-hydroxy-2-sulfonatoethyl)amino]-2-oxoethylidene]amino]oxy-2-methylpropanoate (PubChem CID 172919093) has the molecular formula C11H14N4Na2O8S2 and a molecular weight of 440.37 g/mol. Its IUPAC name is disodium;2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-[(2-hydroxy-2-sulfonatoethyl)amino]-2-oxoethylidene]amino]oxy-2-methylpropanoate.
| Compound Name | disodium;2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-[(2-hydroxy-2-sulfonatoethyl)amino]-2-oxoethylidene]amino]oxy-2-methylpropanoate |
|---|---|
| PubChem CID | 172919093 |
| Molecular Formula | C11H14N4Na2O8S2 |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 440.00 |
| IUPAC Name | disodium;2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-[(2-hydroxy-2-sulfonatoethyl)amino]-2-oxoethylidene]amino]oxy-2-methylpropanoate |
| SMILES | CC(C)(O/N=C(\C(=O)NCC(O)S(=O)(=O)[O-])c1csc(N)n1)C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C11H16N4O8S2.2Na/c1-11(2,9(18)19)23-15-7(5-4-24-10(12)14-5)8(17)13-3-6(16)25(20,21)22;;/h4,6,16H,3H2,1-2H3,(H2,12,14)(H,13,17)(H,18,19)(H,20,21,22);;/q;2*+1/p-2/b15-7-;; |
| InChIKey | INIUASGHNZLRRU-XRXZUQKVSA-L |
| XLogP | -9.04 |
| TPSA | 207.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | -9.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|