C13H17KN5O8PS — CID 70695259
potassium 2-[(E)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(3S)-1-[hydroxy(methyl)phosphoryl]oxy-2-oxoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoate (PubChem CID 70695259) has the molecular formula C13H17KN5O8PS and a molecular weight of 473.45 g/mol. Its IUPAC name is potassium 2-[(E)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(3S)-1-[hydroxy(methyl)phosphoryl]oxy-2-oxoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoate.
| Compound Name | potassium 2-[(E)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(3S)-1-[hydroxy(methyl)phosphoryl]oxy-2-oxoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoate |
|---|---|
| PubChem CID | 70695259 |
| Molecular Formula | C13H17KN5O8PS |
| Molecular Weight | 473.45 g/mol |
| Exact Mass | 473.02 |
| IUPAC Name | potassium 2-[(E)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(3S)-1-[hydroxy(methyl)phosphoryl]oxy-2-oxoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoate |
| SMILES | CC(C)(O/N=C(/C(=O)N[C@H]1CN(OP(C)(=O)O)C1=O)c1csc(N)n1)C(=O)[O-].[K+] |
| InChI | InChI=1S/C13H18N5O8PS.K/c1-13(2,11(21)22)25-17-8(7-5-28-12(14)16-7)9(19)15-6-4-18(10(6)20)26-27(3,23)24;/h5-6H,4H2,1-3H3,(H2,14,16)(H,15,19)(H,21,22)(H,23,24);/q;+1/p-1/b17-8+;/t6-;/m0./s1 |
| InChIKey | XXCYTMNYLQLIEB-DNEWDHDASA-M |
| XLogP | -4.95 |
| TPSA | 196.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.45 |
| LogP ≤ 5 | -4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|