C9H10KN5O6S2 — CID 23680750
potassium (3S)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-oxoazetidine-1-sulfonate (PubChem CID 23680750) has the molecular formula C9H10KN5O6S2 and a molecular weight of 387.44 g/mol. Its IUPAC name is potassium (3S)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-oxoazetidine-1-sulfonate.
| Compound Name | potassium (3S)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-oxoazetidine-1-sulfonate |
|---|---|
| PubChem CID | 23680750 |
| Molecular Formula | C9H10KN5O6S2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 386.97 |
| IUPAC Name | potassium (3S)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-oxoazetidine-1-sulfonate |
| SMILES | CO/N=C(\C(=O)N[C@H]1CN(S(=O)(=O)[O-])C1=O)c1csc(N)n1.[K+] |
| InChI | InChI=1S/C9H11N5O6S2.K/c1-20-13-6(5-3-21-9(10)12-5)7(15)11-4-2-14(8(4)16)22(17,18)19;/h3-4H,2H2,1H3,(H2,10,12)(H,11,15)(H,17,18,19);/q;+1/p-1/b13-6-;/t4-;/m0./s1 |
| InChIKey | HWHONETXZUJCIB-VWQSJHCDSA-M |
| XLogP | -5.13 |
| TPSA | 167.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | -5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|