C17H16N5NaO6S2 — CID 88703971
sodium 3-[(Z)-2-[3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]phenyl]ethenyl]-2-oxoazetidine-1-sulfonate (PubChem CID 88703971) has the molecular formula C17H16N5NaO6S2 and a molecular weight of 473.47 g/mol. Its IUPAC name is sodium 3-[(Z)-2-[3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]phenyl]ethenyl]-2-oxoazetidine-1-sulfonate.
| Compound Name | sodium 3-[(Z)-2-[3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]phenyl]ethenyl]-2-oxoazetidine-1-sulfonate |
|---|---|
| PubChem CID | 88703971 |
| Molecular Formula | C17H16N5NaO6S2 |
| Molecular Weight | 473.47 g/mol |
| Exact Mass | 473.04 |
| IUPAC Name | sodium 3-[(Z)-2-[3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]phenyl]ethenyl]-2-oxoazetidine-1-sulfonate |
| SMILES | CO/N=C(\C(=O)Nc1cccc(/C=C\C2CN(S(=O)(=O)[O-])C2=O)c1)c1csc(N)n1.[Na+] |
| InChI | InChI=1S/C17H17N5O6S2.Na/c1-28-21-14(13-9-29-17(18)20-13)15(23)19-12-4-2-3-10(7-12)5-6-11-8-22(16(11)24)30(25,26)27;/h2-7,9,11H,8H2,1H3,(H2,18,20)(H,19,23)(H,25,26,27);/q;+1/p-1/b6-5-,21-14-; |
| InChIKey | CWDABOCZDNGGKZ-QBGRDQTESA-M |
| XLogP | -2.35 |
| TPSA | 167.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.47 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|