C10H13N7O6S2 — CID 88780329
(3S)-1-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-oxo-N-sulfamoylazetidine-3-carboxamide (PubChem CID 88780329) has the molecular formula C10H13N7O6S2 and a molecular weight of 391.39 g/mol. Its IUPAC name is (3S)-1-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-oxo-N-sulfamoylazetidine-3-carboxamide.
| Compound Name | (3S)-1-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-oxo-N-sulfamoylazetidine-3-carboxamide |
|---|---|
| PubChem CID | 88780329 |
| Molecular Formula | C10H13N7O6S2 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | (3S)-1-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-oxo-N-sulfamoylazetidine-3-carboxamide |
| SMILES | CO/N=C(\C(=O)NN1C[C@H](C(=O)NS(N)(=O)=O)C1=O)c1csc(N)n1 |
| InChI | InChI=1S/C10H13N7O6S2/c1-23-15-6(5-3-24-10(11)13-5)8(19)14-17-2-4(9(17)20)7(18)16-25(12,21)22/h3-4H,2H2,1H3,(H2,11,13)(H,14,19)(H,16,18)(H2,12,21,22)/b15-6-/t4-/m1/s1 |
| InChIKey | FVEXDEDATDORGH-HLNIPZQDSA-N |
| XLogP | -3.11 |
| TPSA | 199.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | -3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|