C12H12N3NaO6S — CID 173396218
sodium 3-[(2-methoxyimino-2-phenylacetyl)amino]-2-oxoazetidine-1-sulfonate (PubChem CID 173396218) has the molecular formula C12H12N3NaO6S and a molecular weight of 349.30 g/mol. Its IUPAC name is sodium 3-[(2-methoxyimino-2-phenylacetyl)amino]-2-oxoazetidine-1-sulfonate.
| Compound Name | sodium 3-[(2-methoxyimino-2-phenylacetyl)amino]-2-oxoazetidine-1-sulfonate |
|---|---|
| PubChem CID | 173396218 |
| Molecular Formula | C12H12N3NaO6S |
| Molecular Weight | 349.30 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | sodium 3-[(2-methoxyimino-2-phenylacetyl)amino]-2-oxoazetidine-1-sulfonate |
| SMILES | CON=C(C(=O)NC1CN(S(=O)(=O)[O-])C1=O)c1ccccc1.[Na+] |
| InChI | InChI=1S/C12H13N3O6S.Na/c1-21-14-10(8-5-3-2-4-6-8)11(16)13-9-7-15(12(9)17)22(18,19)20;/h2-6,9H,7H2,1H3,(H,13,16)(H,18,19,20);/q;+1/p-1 |
| InChIKey | OGNOPTUPUXWEMC-UHFFFAOYSA-M |
| XLogP | -4.17 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.30 |
| LogP ≤ 5 | -4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|