C21H21N3O5S — CID 73188330
methyl 2-[3-[(2-hydroxyimino-2-phenylacetyl)amino]-2-oxoazetidin-1-yl]-3-phenylsulfanylpropanoate (PubChem CID 73188330) has the molecular formula C21H21N3O5S and a molecular weight of 427.48 g/mol. Its IUPAC name is methyl 2-[3-[(2-hydroxyimino-2-phenylacetyl)amino]-2-oxoazetidin-1-yl]-3-phenylsulfanylpropanoate.
| Compound Name | methyl 2-[3-[(2-hydroxyimino-2-phenylacetyl)amino]-2-oxoazetidin-1-yl]-3-phenylsulfanylpropanoate |
|---|---|
| PubChem CID | 73188330 |
| Molecular Formula | C21H21N3O5S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | methyl 2-[3-[(2-hydroxyimino-2-phenylacetyl)amino]-2-oxoazetidin-1-yl]-3-phenylsulfanylpropanoate |
| SMILES | COC(=O)C(CSc1ccccc1)N1CC(NC(=O)C(=NO)c2ccccc2)C1=O |
| InChI | InChI=1S/C21H21N3O5S/c1-29-21(27)17(13-30-15-10-6-3-7-11-15)24-12-16(20(24)26)22-19(25)18(23-28)14-8-4-2-5-9-14/h2-11,16-17,28H,12-13H2,1H3,(H,22,25) |
| InChIKey | UYCQQOXBRYYYSZ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|