C30H30N4O9 — CID 86739640
2-amino-4-[4-[C-[[1-[carboxy-(4-phenylmethoxyphenyl)methyl]-2-oxoazetidin-3-yl]carbamoyl]-N-hydroxycarbonimidoyl]phenoxy]butanoic acid (PubChem CID 86739640) has the molecular formula C30H30N4O9 and a molecular weight of 590.59 g/mol. Its IUPAC name is 2-amino-4-[4-[C-[[1-[carboxy-(4-phenylmethoxyphenyl)methyl]-2-oxoazetidin-3-yl]carbamoyl]-N-hydroxycarbonimidoyl]phenoxy]butanoic acid.
| Compound Name | 2-amino-4-[4-[C-[[1-[carboxy-(4-phenylmethoxyphenyl)methyl]-2-oxoazetidin-3-yl]carbamoyl]-N-hydroxycarbonimidoyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 86739640 |
| Molecular Formula | C30H30N4O9 |
| Molecular Weight | 590.59 g/mol |
| Exact Mass | 590.20 |
| IUPAC Name | 2-amino-4-[4-[C-[[1-[carboxy-(4-phenylmethoxyphenyl)methyl]-2-oxoazetidin-3-yl]carbamoyl]-N-hydroxycarbonimidoyl]phenoxy]butanoic acid |
| SMILES | NC(CCOc1ccc(C(=NO)C(=O)NC2CN(C(C(=O)O)c3ccc(OCc4ccccc4)cc3)C2=O)cc1)C(=O)O |
| InChI | InChI=1S/C30H30N4O9/c31-23(29(37)38)14-15-42-21-10-6-19(7-11-21)25(33-41)27(35)32-24-16-34(28(24)36)26(30(39)40)20-8-12-22(13-9-20)43-17-18-4-2-1-3-5-18/h1-13,23-24,26,41H,14-17,31H2,(H,32,35)(H,37,38)(H,39,40) |
| InChIKey | PACKDRMXLNPOCY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 201.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.59 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|