C23H24N4O8 — CID 10005551
2-amino-4-[4-[(Z)-C-[[1-[carboxy(phenyl)methyl]-2-oxoazetidin-3-yl]carbamoyl]-N-hydroxycarbonimidoyl]phenoxy]butanoic acid (PubChem CID 10005551) has the molecular formula C23H24N4O8 and a molecular weight of 484.47 g/mol. Its IUPAC name is 2-amino-4-[4-[(Z)-C-[[1-[carboxy(phenyl)methyl]-2-oxoazetidin-3-yl]carbamoyl]-N-hydroxycarbonimidoyl]phenoxy]butanoic acid.
| Compound Name | 2-amino-4-[4-[(Z)-C-[[1-[carboxy(phenyl)methyl]-2-oxoazetidin-3-yl]carbamoyl]-N-hydroxycarbonimidoyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 10005551 |
| Molecular Formula | C23H24N4O8 |
| Molecular Weight | 484.47 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 2-amino-4-[4-[(Z)-C-[[1-[carboxy(phenyl)methyl]-2-oxoazetidin-3-yl]carbamoyl]-N-hydroxycarbonimidoyl]phenoxy]butanoic acid |
| SMILES | NC(CCOc1ccc(/C(=N/O)C(=O)NC2CN(C(C(=O)O)c3ccccc3)C2=O)cc1)C(=O)O |
| InChI | InChI=1S/C23H24N4O8/c24-16(22(30)31)10-11-35-15-8-6-13(7-9-15)18(26-34)20(28)25-17-12-27(21(17)29)19(23(32)33)14-4-2-1-3-5-14/h1-9,16-17,19,34H,10-12,24H2,(H,25,28)(H,30,31)(H,32,33)/b26-18- |
| InChIKey | QHLZMEYRKOBONQ-ITYLOYPMSA-N |
| XLogP | 0.20 |
| TPSA | 191.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.47 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|