C28H27NO4 — CID 134920392
benzyl (2R)-2-[(3R)-2-oxo-3-prop-1-en-2-ylazetidin-1-yl]-2-(4-phenylmethoxyphenyl)acetate (PubChem CID 134920392) has the molecular formula C28H27NO4 and a molecular weight of 441.53 g/mol. Its IUPAC name is benzyl (2R)-2-[(3R)-2-oxo-3-prop-1-en-2-ylazetidin-1-yl]-2-(4-phenylmethoxyphenyl)acetate.
| Compound Name | benzyl (2R)-2-[(3R)-2-oxo-3-prop-1-en-2-ylazetidin-1-yl]-2-(4-phenylmethoxyphenyl)acetate |
|---|---|
| PubChem CID | 134920392 |
| Molecular Formula | C28H27NO4 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | benzyl (2R)-2-[(3R)-2-oxo-3-prop-1-en-2-ylazetidin-1-yl]-2-(4-phenylmethoxyphenyl)acetate |
| SMILES | C=C(C)[C@@H]1CN([C@@H](C(=O)OCc2ccccc2)c2ccc(OCc3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C28H27NO4/c1-20(2)25-17-29(27(25)30)26(28(31)33-19-22-11-7-4-8-12-22)23-13-15-24(16-14-23)32-18-21-9-5-3-6-10-21/h3-16,25-26H,1,17-19H2,2H3/t25-,26+/m0/s1 |
| InChIKey | WJNCPIHEIKUTKZ-IZZNHLLZSA-N |
| XLogP | 5.08 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|