C32H26Cl2N2O4 — CID 57283102
benzyl 2-[(2R,3S)-2-chloro-3-[[chloro(phenyl)methylidene]amino]-4-oxoazetidin-1-yl]-2-(4-phenylmethoxyphenyl)acetate (PubChem CID 57283102) has the molecular formula C32H26Cl2N2O4 and a molecular weight of 573.48 g/mol. Its IUPAC name is benzyl 2-[(2R,3S)-2-chloro-3-[[chloro(phenyl)methylidene]amino]-4-oxoazetidin-1-yl]-2-(4-phenylmethoxyphenyl)acetate.
| Compound Name | benzyl 2-[(2R,3S)-2-chloro-3-[[chloro(phenyl)methylidene]amino]-4-oxoazetidin-1-yl]-2-(4-phenylmethoxyphenyl)acetate |
|---|---|
| PubChem CID | 57283102 |
| Molecular Formula | C32H26Cl2N2O4 |
| Molecular Weight | 573.48 g/mol |
| Exact Mass | 572.13 |
| IUPAC Name | benzyl 2-[(2R,3S)-2-chloro-3-[[chloro(phenyl)methylidene]amino]-4-oxoazetidin-1-yl]-2-(4-phenylmethoxyphenyl)acetate |
| SMILES | O=C(OCc1ccccc1)C(c1ccc(OCc2ccccc2)cc1)N1C(=O)[C@H](/N=C(\Cl)c2ccccc2)[C@H]1Cl |
| InChI | InChI=1S/C32H26Cl2N2O4/c33-29(25-14-8-3-9-15-25)35-27-30(34)36(31(27)37)28(32(38)40-21-23-12-6-2-7-13-23)24-16-18-26(19-17-24)39-20-22-10-4-1-5-11-22/h1-19,27-28,30H,20-21H2/b35-29-/t27-,28?,30+/m1/s1 |
| InChIKey | RTYZTLVLXCDBSM-MDKZCCTCSA-N |
| XLogP | 6.51 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.48 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|