C16H20N5NaO7S — CID 23705509
sodium 3-[[2-[[3-amino-4-(methylamino)-4-oxobutanoyl]amino]-2-phenylacetyl]amino]-2-oxoazetidine-1-sulfonate (PubChem CID 23705509) has the molecular formula C16H20N5NaO7S and a molecular weight of 449.42 g/mol. Its IUPAC name is sodium 3-[[2-[[3-amino-4-(methylamino)-4-oxobutanoyl]amino]-2-phenylacetyl]amino]-2-oxoazetidine-1-sulfonate.
| Compound Name | sodium 3-[[2-[[3-amino-4-(methylamino)-4-oxobutanoyl]amino]-2-phenylacetyl]amino]-2-oxoazetidine-1-sulfonate |
|---|---|
| PubChem CID | 23705509 |
| Molecular Formula | C16H20N5NaO7S |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | sodium 3-[[2-[[3-amino-4-(methylamino)-4-oxobutanoyl]amino]-2-phenylacetyl]amino]-2-oxoazetidine-1-sulfonate |
| SMILES | CNC(=O)C(N)CC(=O)NC(C(=O)NC1CN(S(=O)(=O)[O-])C1=O)c1ccccc1.[Na+] |
| InChI | InChI=1S/C16H21N5O7S.Na/c1-18-14(23)10(17)7-12(22)20-13(9-5-3-2-4-6-9)15(24)19-11-8-21(16(11)25)29(26,27)28;/h2-6,10-11,13H,7-8,17H2,1H3,(H,18,23)(H,19,24)(H,20,22)(H,26,27,28);/q;+1/p-1 |
| InChIKey | VRMODNZYBSXRBR-UHFFFAOYSA-M |
| XLogP | -5.90 |
| TPSA | 190.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | -5.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|