C15H18N7NaO8S2 — CID 88629749
sodium 3-[[2-(2-amino-1,3-thiazol-4-yl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-oxoazetidine-1-sulfonate (PubChem CID 88629749) has the molecular formula C15H18N7NaO8S2 and a molecular weight of 511.47 g/mol. Its IUPAC name is sodium 3-[[2-(2-amino-1,3-thiazol-4-yl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-oxoazetidine-1-sulfonate.
| Compound Name | sodium 3-[[2-(2-amino-1,3-thiazol-4-yl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-oxoazetidine-1-sulfonate |
|---|---|
| PubChem CID | 88629749 |
| Molecular Formula | C15H18N7NaO8S2 |
| Molecular Weight | 511.47 g/mol |
| Exact Mass | 511.06 |
| IUPAC Name | sodium 3-[[2-(2-amino-1,3-thiazol-4-yl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-oxoazetidine-1-sulfonate |
| SMILES | CCN1CCN(C(=O)NC(C(=O)NC2CN(S(=O)(=O)[O-])C2=O)c2csc(N)n2)C(=O)C1=O.[Na+] |
| InChI | InChI=1S/C15H19N7O8S2.Na/c1-2-20-3-4-21(13(26)12(20)25)15(27)19-9(8-6-31-14(16)18-8)10(23)17-7-5-22(11(7)24)32(28,29)30;/h6-7,9H,2-5H2,1H3,(H2,16,18)(H,17,23)(H,19,27)(H,28,29,30);/q;+1/p-1 |
| InChIKey | RZBAITIUGCJTSF-UHFFFAOYSA-M |
| XLogP | -6.04 |
| TPSA | 215.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.47 |
| LogP ≤ 5 | -6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|