C31H28KN5O5S — CID 88600380
potassium 2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetate (PubChem CID 88600380) has the molecular formula C31H28KN5O5S and a molecular weight of 621.76 g/mol. Its IUPAC name is potassium 2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetate.
| Compound Name | potassium 2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 88600380 |
| Molecular Formula | C31H28KN5O5S |
| Molecular Weight | 621.76 g/mol |
| Exact Mass | 621.14 |
| IUPAC Name | potassium 2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetate |
| SMILES | CCN1CCN(C(=O)NC(C(=O)[O-])c2csc(NC(c3ccccc3)(c3ccccc3)c3ccccc3)n2)C(=O)C1=O.[K+] |
| InChI | InChI=1S/C31H29N5O5S.K/c1-2-35-18-19-36(27(38)26(35)37)30(41)33-25(28(39)40)24-20-42-29(32-24)34-31(21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23;/h3-17,20,25H,2,18-19H2,1H3,(H,32,34)(H,33,41)(H,39,40);/q;+1/p-1 |
| InChIKey | BWCHCEQUAMREAB-UHFFFAOYSA-M |
| XLogP | -0.26 |
| TPSA | 134.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.76 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|