C22H24BN5O8S — CID 161294977
(3S)-3-[3-(2-amino-1,3-thiazol-4-yl)-3-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 161294977) has the molecular formula C22H24BN5O8S and a molecular weight of 529.34 g/mol. Its IUPAC name is (3S)-3-[3-(2-amino-1,3-thiazol-4-yl)-3-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3S)-3-[3-(2-amino-1,3-thiazol-4-yl)-3-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 161294977 |
| Molecular Formula | C22H24BN5O8S |
| Molecular Weight | 529.34 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | (3S)-3-[3-(2-amino-1,3-thiazol-4-yl)-3-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CCN1CCN(C(=O)NC(C(=O)C[C@@H]2Cc3cccc(C(=O)O)c3OB2O)c2csc(N)n2)C(=O)C1=O |
| InChI | InChI=1S/C22H24BN5O8S/c1-2-27-6-7-28(19(31)18(27)30)22(34)26-16(14-10-37-21(24)25-14)15(29)9-12-8-11-4-3-5-13(20(32)33)17(11)36-23(12)35/h3-5,10,12,16,35H,2,6-9H2,1H3,(H2,24,25)(H,26,34)(H,32,33)/t12-,16?/m0/s1 |
| InChIKey | VGVXDGKLZPUUKM-HKALDPMFSA-N |
| XLogP | 0.31 |
| TPSA | 192.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.34 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|