C24H26BN3O7S — CID 160687460
N-[3-[(3R)-8-acetyl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-2-oxo-1-thiophen-3-ylpropyl]-4-ethyl-2,3-dioxopiperazine-1-carboxamide (PubChem CID 160687460) has the molecular formula C24H26BN3O7S and a molecular weight of 511.37 g/mol. Its IUPAC name is N-[3-[(3R)-8-acetyl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-2-oxo-1-thiophen-3-ylpropyl]-4-ethyl-2,3-dioxopiperazine-1-carboxamide.
| Compound Name | N-[3-[(3R)-8-acetyl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-2-oxo-1-thiophen-3-ylpropyl]-4-ethyl-2,3-dioxopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 160687460 |
| Molecular Formula | C24H26BN3O7S |
| Molecular Weight | 511.37 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | N-[3-[(3R)-8-acetyl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-2-oxo-1-thiophen-3-ylpropyl]-4-ethyl-2,3-dioxopiperazine-1-carboxamide |
| SMILES | CCN1CCN(C(=O)NC(C(=O)C[C@H]2Cc3cccc(C(C)=O)c3OB2O)c2ccsc2)C(=O)C1=O |
| InChI | InChI=1S/C24H26BN3O7S/c1-3-27-8-9-28(23(32)22(27)31)24(33)26-20(16-7-10-36-13-16)19(30)12-17-11-15-5-4-6-18(14(2)29)21(15)35-25(17)34/h4-7,10,13,17,20,34H,3,8-9,11-12H2,1-2H3,(H,26,33)/t17-,20?/m1/s1 |
| InChIKey | RIKVJODHKWMAOQ-DIAVIDTQSA-N |
| XLogP | 1.84 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|