C24H28BN5O8S — CID 148909513
(3R)-3-[3-(2-amino-1,3-thiazol-4-yl)-3-[[4-(2-methylpropyl)-2,3-dioxopiperazine-1-carbonyl]amino]-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 148909513) has the molecular formula C24H28BN5O8S and a molecular weight of 557.39 g/mol. Its IUPAC name is (3R)-3-[3-(2-amino-1,3-thiazol-4-yl)-3-[[4-(2-methylpropyl)-2,3-dioxopiperazine-1-carbonyl]amino]-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[3-(2-amino-1,3-thiazol-4-yl)-3-[[4-(2-methylpropyl)-2,3-dioxopiperazine-1-carbonyl]amino]-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 148909513 |
| Molecular Formula | C24H28BN5O8S |
| Molecular Weight | 557.39 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | (3R)-3-[3-(2-amino-1,3-thiazol-4-yl)-3-[[4-(2-methylpropyl)-2,3-dioxopiperazine-1-carbonyl]amino]-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CC(C)CN1CCN(C(=O)NC(C(=O)C[C@H]2Cc3cccc(C(=O)O)c3OB2O)c2csc(N)n2)C(=O)C1=O |
| InChI | InChI=1S/C24H28BN5O8S/c1-12(2)10-29-6-7-30(21(33)20(29)32)24(36)28-18(16-11-39-23(26)27-16)17(31)9-14-8-13-4-3-5-15(22(34)35)19(13)38-25(14)37/h3-5,11-12,14,18,37H,6-10H2,1-2H3,(H2,26,27)(H,28,36)(H,34,35)/t14-,18?/m1/s1 |
| InChIKey | PIIVGDPHPZEPDV-IKJXHCRLSA-N |
| XLogP | 0.95 |
| TPSA | 192.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.39 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|