C22H24BN5O8S — CID 164768125
(3R)-3-[[2-(2-amino-1,3-thiazol-4-yl)-4-(4-ethyl-2,3-dioxopiperazin-1-yl)-4-oxobutanoyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 164768125) has the molecular formula C22H24BN5O8S and a molecular weight of 529.34 g/mol. Its IUPAC name is (3R)-3-[[2-(2-amino-1,3-thiazol-4-yl)-4-(4-ethyl-2,3-dioxopiperazin-1-yl)-4-oxobutanoyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[[2-(2-amino-1,3-thiazol-4-yl)-4-(4-ethyl-2,3-dioxopiperazin-1-yl)-4-oxobutanoyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 164768125 |
| Molecular Formula | C22H24BN5O8S |
| Molecular Weight | 529.34 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | (3R)-3-[[2-(2-amino-1,3-thiazol-4-yl)-4-(4-ethyl-2,3-dioxopiperazin-1-yl)-4-oxobutanoyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CCN1CCN(C(=O)CC(C(=O)N[C@H]2Cc3cccc(C(=O)O)c3OB2O)c2csc(N)n2)C(=O)C1=O |
| InChI | InChI=1S/C22H24BN5O8S/c1-2-27-6-7-28(20(32)19(27)31)16(29)9-13(14-10-37-22(24)25-14)18(30)26-15-8-11-4-3-5-12(21(33)34)17(11)36-23(15)35/h3-5,10,13,15,35H,2,6-9H2,1H3,(H2,24,25)(H,26,30)(H,33,34)/t13?,15-/m0/s1 |
| InChIKey | CANYIVUAQKXNRZ-WUJWULDRSA-N |
| XLogP | -0.75 |
| TPSA | 192.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.34 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|