C22H25BN6O8S2 — CID 156746462
(3R)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-hydroxy-7-methylsulfanyl-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 156746462) has the molecular formula C22H25BN6O8S2 and a molecular weight of 576.42 g/mol. Its IUPAC name is (3R)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-hydroxy-7-methylsulfanyl-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-hydroxy-7-methylsulfanyl-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 156746462 |
| Molecular Formula | C22H25BN6O8S2 |
| Molecular Weight | 576.42 g/mol |
| Exact Mass | 576.13 |
| IUPAC Name | (3R)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-hydroxy-7-methylsulfanyl-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CCN1CCN(C(=O)NC(C(=O)N[C@H]2Cc3ccc(SC)c(C(=O)O)c3OB2O)c2csc(N)n2)C(=O)C1=O |
| InChI | InChI=1S/C22H25BN6O8S2/c1-3-28-6-7-29(19(32)18(28)31)22(35)27-15(11-9-39-21(24)25-11)17(30)26-13-8-10-4-5-12(38-2)14(20(33)34)16(10)37-23(13)36/h4-5,9,13,15,36H,3,6-8H2,1-2H3,(H2,24,25)(H,26,30)(H,27,35)(H,33,34)/t13-,15?/m0/s1 |
| InChIKey | WUKQEEDLTDWVOX-CFMCSPIPSA-N |
| XLogP | -0.27 |
| TPSA | 204.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.42 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|