C22H25BN6O8S — CID 150142515
(3R)-3-[[(2R)-2-(2-amino-1,3-thiazol-4-yl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]propanoyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 150142515) has the molecular formula C22H25BN6O8S and a molecular weight of 544.36 g/mol. Its IUPAC name is (3R)-3-[[(2R)-2-(2-amino-1,3-thiazol-4-yl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]propanoyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[[(2R)-2-(2-amino-1,3-thiazol-4-yl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]propanoyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 150142515 |
| Molecular Formula | C22H25BN6O8S |
| Molecular Weight | 544.36 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | (3R)-3-[[(2R)-2-(2-amino-1,3-thiazol-4-yl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]propanoyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CCN1CCN(C(=O)N[C@@](C)(C(=O)N[C@H]2Cc3cccc(C(=O)O)c3OB2O)c2csc(N)n2)C(=O)C1=O |
| InChI | InChI=1S/C22H25BN6O8S/c1-3-28-7-8-29(17(31)16(28)30)21(35)27-22(2,13-10-38-20(24)25-13)19(34)26-14-9-11-5-4-6-12(18(32)33)15(11)37-23(14)36/h4-6,10,14,36H,3,7-9H2,1-2H3,(H2,24,25)(H,26,34)(H,27,35)(H,32,33)/t14-,22+/m0/s1 |
| InChIKey | FDOSTEIOHOULGB-RCDICMHDSA-N |
| XLogP | -0.82 |
| TPSA | 204.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.36 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|