C20H22BN7O8S — CID 150364497
(3R)-3-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 150364497) has the molecular formula C20H22BN7O8S and a molecular weight of 531.32 g/mol. Its IUPAC name is (3R)-3-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 150364497 |
| Molecular Formula | C20H22BN7O8S |
| Molecular Weight | 531.32 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | (3R)-3-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CCN1CCN(C(=O)NC(C(=O)N[C@H]2Cc3cccc(C(=O)O)c3OB2O)c2nsc(N)n2)C(=O)C1=O |
| InChI | InChI=1S/C20H22BN7O8S/c1-2-27-6-7-28(17(31)16(27)30)20(34)24-12(14-25-19(22)37-26-14)15(29)23-11-8-9-4-3-5-10(18(32)33)13(9)36-21(11)35/h3-5,11-12,35H,2,6-8H2,1H3,(H,23,29)(H,24,34)(H,32,33)(H2,22,25,26)/t11-,12?/m0/s1 |
| InChIKey | GWKITEJBICXVLY-PXYINDEMSA-N |
| XLogP | -1.60 |
| TPSA | 217.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.32 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|