C26H28BN5O10 — CID 156746325
(3R)-3-[[2-(3-acetamido-4-hydroxyphenyl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 156746325) has the molecular formula C26H28BN5O10 and a molecular weight of 581.35 g/mol. Its IUPAC name is (3R)-3-[[2-(3-acetamido-4-hydroxyphenyl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[[2-(3-acetamido-4-hydroxyphenyl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 156746325 |
| Molecular Formula | C26H28BN5O10 |
| Molecular Weight | 581.35 g/mol |
| Exact Mass | 581.19 |
| IUPAC Name | (3R)-3-[[2-(3-acetamido-4-hydroxyphenyl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CCN1CCN(C(=O)NC(C(=O)N[C@H]2Cc3cccc(C(=O)O)c3OB2O)c2ccc(O)c(NC(C)=O)c2)C(=O)C1=O |
| InChI | InChI=1S/C26H28BN5O10/c1-3-31-9-10-32(24(37)23(31)36)26(40)30-20(14-7-8-18(34)17(11-14)28-13(2)33)22(35)29-19-12-15-5-4-6-16(25(38)39)21(15)42-27(19)41/h4-8,11,19-20,34,41H,3,9-10,12H2,1-2H3,(H,28,33)(H,29,35)(H,30,40)(H,38,39)/t19-,20?/m0/s1 |
| InChIKey | HCSXWDKIGVLTBV-XJDOXCRVSA-N |
| XLogP | -0.37 |
| TPSA | 214.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.35 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|