C27H29BN4O11 — CID 161357311
(3R)-3-[[(2R)-5-(3,4-dihydroxyphenyl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-5-oxopentanoyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 161357311) has the molecular formula C27H29BN4O11 and a molecular weight of 596.36 g/mol. Its IUPAC name is (3R)-3-[[(2R)-5-(3,4-dihydroxyphenyl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-5-oxopentanoyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[[(2R)-5-(3,4-dihydroxyphenyl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-5-oxopentanoyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 161357311 |
| Molecular Formula | C27H29BN4O11 |
| Molecular Weight | 596.36 g/mol |
| Exact Mass | 596.19 |
| IUPAC Name | (3R)-3-[[(2R)-5-(3,4-dihydroxyphenyl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-5-oxopentanoyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CCN1CCN(C(=O)N[C@H](CCC(=O)c2ccc(O)c(O)c2)C(=O)N[C@H]2Cc3cccc(C(=O)O)c3OB2O)C(=O)C1=O |
| InChI | InChI=1S/C27H29BN4O11/c1-2-31-10-11-32(25(38)24(31)37)27(41)29-17(7-9-18(33)14-6-8-19(34)20(35)12-14)23(36)30-21-13-15-4-3-5-16(26(39)40)22(15)43-28(21)42/h3-6,8,12,17,21,34-35,42H,2,7,9-11,13H2,1H3,(H,29,41)(H,30,36)(H,39,40)/t17-,21+/m1/s1 |
| InChIKey | VOSBWTYJXQWIKL-UTKZUKDTSA-N |
| XLogP | -0.33 |
| TPSA | 223.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.36 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|