C25H25BClN3O10 — CID 159378085
(3R)-3-[3-(2-chloro-4,5-dihydroxyphenyl)-3-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 159378085) has the molecular formula C25H25BClN3O10 and a molecular weight of 573.75 g/mol. Its IUPAC name is (3R)-3-[3-(2-chloro-4,5-dihydroxyphenyl)-3-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[3-(2-chloro-4,5-dihydroxyphenyl)-3-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 159378085 |
| Molecular Formula | C25H25BClN3O10 |
| Molecular Weight | 573.75 g/mol |
| Exact Mass | 573.13 |
| IUPAC Name | (3R)-3-[3-(2-chloro-4,5-dihydroxyphenyl)-3-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CCN1CCN(C(=O)NC(C(=O)C[C@H]2Cc3cccc(C(=O)O)c3OB2O)c2cc(O)c(O)cc2Cl)C(=O)C1=O |
| InChI | InChI=1S/C25H25BClN3O10/c1-2-29-6-7-30(23(35)22(29)34)25(38)28-20(15-10-17(31)18(32)11-16(15)27)19(33)9-13-8-12-4-3-5-14(24(36)37)21(12)40-26(13)39/h3-5,10-11,13,20,31-32,39H,2,6-9H2,1H3,(H,28,38)(H,36,37)/t13-,20?/m1/s1 |
| InChIKey | LKOKUNHLTOWLLJ-CRIUFTBBSA-N |
| XLogP | 1.34 |
| TPSA | 194.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.75 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|