C21H27BN4O10S — CID 158537903
(3R)-3-[3-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxo-5-sulfamoylpentyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 158537903) has the molecular formula C21H27BN4O10S and a molecular weight of 538.34 g/mol. Its IUPAC name is (3R)-3-[3-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxo-5-sulfamoylpentyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[3-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxo-5-sulfamoylpentyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 158537903 |
| Molecular Formula | C21H27BN4O10S |
| Molecular Weight | 538.34 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | (3R)-3-[3-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxo-5-sulfamoylpentyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CCN1CCN(C(=O)NC(CCS(N)(=O)=O)C(=O)C[C@H]2Cc3cccc(C(=O)O)c3OB2O)C(=O)C1=O |
| InChI | InChI=1S/C21H27BN4O10S/c1-2-25-7-8-26(19(29)18(25)28)21(32)24-15(6-9-37(23,34)35)16(27)11-13-10-12-4-3-5-14(20(30)31)17(12)36-22(13)33/h3-5,13,15,33H,2,6-11H2,1H3,(H,24,32)(H,30,31)(H2,23,34,35)/t13-,15?/m1/s1 |
| InChIKey | HODXRCOBZLUAEI-AFYYWNPRSA-N |
| XLogP | -1.42 |
| TPSA | 213.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.34 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|