C21H25BFN3O9 — CID 158090234
(3R)-3-[(3R,4R)-3-[[4-(2-fluoroethyl)-2,3-dioxopiperazine-1-carbonyl]amino]-4-hydroxy-2-oxopentyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 158090234) has the molecular formula C21H25BFN3O9 and a molecular weight of 493.25 g/mol. Its IUPAC name is (3R)-3-[(3R,4R)-3-[[4-(2-fluoroethyl)-2,3-dioxopiperazine-1-carbonyl]amino]-4-hydroxy-2-oxopentyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[(3R,4R)-3-[[4-(2-fluoroethyl)-2,3-dioxopiperazine-1-carbonyl]amino]-4-hydroxy-2-oxopentyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 158090234 |
| Molecular Formula | C21H25BFN3O9 |
| Molecular Weight | 493.25 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | (3R)-3-[(3R,4R)-3-[[4-(2-fluoroethyl)-2,3-dioxopiperazine-1-carbonyl]amino]-4-hydroxy-2-oxopentyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | C[C@@H](O)[C@@H](NC(=O)N1CCN(CCF)C(=O)C1=O)C(=O)C[C@H]1Cc2cccc(C(=O)O)c2OB1O |
| InChI | InChI=1S/C21H25BFN3O9/c1-11(27)16(24-21(33)26-8-7-25(6-5-23)18(29)19(26)30)15(28)10-13-9-12-3-2-4-14(20(31)32)17(12)35-22(13)34/h2-4,11,13,16,27,34H,5-10H2,1H3,(H,24,33)(H,31,32)/t11-,13-,16-/m1/s1 |
| InChIKey | FNZZMCJBOCCCPK-AXAPSJFSSA-N |
| XLogP | -0.77 |
| TPSA | 173.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.25 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|