C24H22BF3N4O9 — CID 156746680
(3R)-3-[[2-(2,6-difluoro-4-hydroxyphenyl)-2-[[4-(2-fluoroethyl)-2,3-dioxopiperazine-1-carbonyl]amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 156746680) has the molecular formula C24H22BF3N4O9 and a molecular weight of 578.27 g/mol. Its IUPAC name is (3R)-3-[[2-(2,6-difluoro-4-hydroxyphenyl)-2-[[4-(2-fluoroethyl)-2,3-dioxopiperazine-1-carbonyl]amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[[2-(2,6-difluoro-4-hydroxyphenyl)-2-[[4-(2-fluoroethyl)-2,3-dioxopiperazine-1-carbonyl]amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 156746680 |
| Molecular Formula | C24H22BF3N4O9 |
| Molecular Weight | 578.27 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | (3R)-3-[[2-(2,6-difluoro-4-hydroxyphenyl)-2-[[4-(2-fluoroethyl)-2,3-dioxopiperazine-1-carbonyl]amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | O=C(O)c1cccc2c1OB(O)[C@@H](NC(=O)C(NC(=O)N1CCN(CCF)C(=O)C1=O)c1c(F)cc(O)cc1F)C2 |
| InChI | InChI=1S/C24H22BF3N4O9/c26-4-5-31-6-7-32(22(36)21(31)35)24(39)30-18(17-14(27)9-12(33)10-15(17)28)20(34)29-16-8-11-2-1-3-13(23(37)38)19(11)41-25(16)40/h1-3,9-10,16,18,33,40H,4-8H2,(H,29,34)(H,30,39)(H,37,38)/t16-,18?/m0/s1 |
| InChIKey | PNDHSJSCTOJHDL-ATNAJCNCSA-N |
| XLogP | -0.10 |
| TPSA | 185.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.27 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|