C24H31BClN3O8 — CID 160810431
N-[1-[(3R)-8-acetyl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-4-chloro-7-hydroxy-2-oxoheptan-3-yl]-4-ethyl-2,3-dioxopiperazine-1-carboxamide (PubChem CID 160810431) has the molecular formula C24H31BClN3O8 and a molecular weight of 535.79 g/mol. Its IUPAC name is N-[1-[(3R)-8-acetyl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-4-chloro-7-hydroxy-2-oxoheptan-3-yl]-4-ethyl-2,3-dioxopiperazine-1-carboxamide.
| Compound Name | N-[1-[(3R)-8-acetyl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-4-chloro-7-hydroxy-2-oxoheptan-3-yl]-4-ethyl-2,3-dioxopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 160810431 |
| Molecular Formula | C24H31BClN3O8 |
| Molecular Weight | 535.79 g/mol |
| Exact Mass | 535.19 |
| IUPAC Name | N-[1-[(3R)-8-acetyl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-4-chloro-7-hydroxy-2-oxoheptan-3-yl]-4-ethyl-2,3-dioxopiperazine-1-carboxamide |
| SMILES | CCN1CCN(C(=O)NC(C(=O)C[C@H]2Cc3cccc(C(C)=O)c3OB2O)C(Cl)CCCO)C(=O)C1=O |
| InChI | InChI=1S/C24H31BClN3O8/c1-3-28-9-10-29(23(34)22(28)33)24(35)27-20(18(26)8-5-11-30)19(32)13-16-12-15-6-4-7-17(14(2)31)21(15)37-25(16)36/h4,6-7,16,18,20,30,36H,3,5,8-13H2,1-2H3,(H,27,35)/t16-,18?,20?/m1/s1 |
| InChIKey | GTHOWXCRHXRJLY-PPDQVPDSSA-N |
| XLogP | 0.78 |
| TPSA | 153.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.79 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|