C15H18N4O4 — CID 19833690
N-(2-amino-2-oxo-1-phenylethyl)-4-ethyl-2,3-dioxopiperazine-1-carboxamide (PubChem CID 19833690) has the molecular formula C15H18N4O4 and a molecular weight of 318.33 g/mol. Its IUPAC name is N-(2-amino-2-oxo-1-phenylethyl)-4-ethyl-2,3-dioxopiperazine-1-carboxamide.
| Compound Name | N-(2-amino-2-oxo-1-phenylethyl)-4-ethyl-2,3-dioxopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 19833690 |
| Molecular Formula | C15H18N4O4 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | N-(2-amino-2-oxo-1-phenylethyl)-4-ethyl-2,3-dioxopiperazine-1-carboxamide |
| SMILES | CCN1CCN(C(=O)NC(C(N)=O)c2ccccc2)C(=O)C1=O |
| InChI | InChI=1S/C15H18N4O4/c1-2-18-8-9-19(14(22)13(18)21)15(23)17-11(12(16)20)10-6-4-3-5-7-10/h3-7,11H,2,8-9H2,1H3,(H2,16,20)(H,17,23) |
| InChIKey | MWJIZCIYRUZIFY-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|