C16H19N4O4Y- — CID 59188807
4-ethyl-N-[2-(methylamino)-2-oxo-1-phenylethyl]-2,3-dioxopiperazine-1-carboxamide;yttrium (PubChem CID 59188807) has the molecular formula C16H19N4O4Y- and a molecular weight of 420.26 g/mol. Its IUPAC name is 4-ethyl-N-[2-(methylamino)-2-oxo-1-phenylethyl]-2,3-dioxopiperazine-1-carboxamide;yttrium.
| Compound Name | 4-ethyl-N-[2-(methylamino)-2-oxo-1-phenylethyl]-2,3-dioxopiperazine-1-carboxamide;yttrium |
|---|---|
| PubChem CID | 59188807 |
| Molecular Formula | C16H19N4O4Y- |
| Molecular Weight | 420.26 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | 4-ethyl-N-[2-(methylamino)-2-oxo-1-phenylethyl]-2,3-dioxopiperazine-1-carboxamide;yttrium |
| SMILES | CCN1CCN(C(=O)NC(C(=O)NC)c2cc[c-]cc2)C(=O)C1=O.[Y] |
| InChI | InChI=1S/C16H19N4O4.Y/c1-3-19-9-10-20(15(23)14(19)22)16(24)18-12(13(21)17-2)11-7-5-4-6-8-11;/h5-8,12H,3,9-10H2,1-2H3,(H,17,21)(H,18,24);/q-1; |
| InChIKey | FUBJSBVVGVVPJU-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.26 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|