C24H33N5O9S — CID 70578048
3-[[2-(4-hydroxyphenyl)-2-[(4-octyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-oxoazetidine-1-sulfonic acid (PubChem CID 70578048) has the molecular formula C24H33N5O9S and a molecular weight of 567.62 g/mol. Its IUPAC name is 3-[[2-(4-hydroxyphenyl)-2-[(4-octyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-oxoazetidine-1-sulfonic acid.
| Compound Name | 3-[[2-(4-hydroxyphenyl)-2-[(4-octyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 70578048 |
| Molecular Formula | C24H33N5O9S |
| Molecular Weight | 567.62 g/mol |
| Exact Mass | 567.20 |
| IUPAC Name | 3-[[2-(4-hydroxyphenyl)-2-[(4-octyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-oxoazetidine-1-sulfonic acid |
| SMILES | CCCCCCCCN1CCN(C(=O)NC(C(=O)NC2CN(S(=O)(=O)O)C2=O)c2ccc(O)cc2)C(=O)C1=O |
| InChI | InChI=1S/C24H33N5O9S/c1-2-3-4-5-6-7-12-27-13-14-28(23(34)22(27)33)24(35)26-19(16-8-10-17(30)11-9-16)20(31)25-18-15-29(21(18)32)39(36,37)38/h8-11,18-19,30H,2-7,12-15H2,1H3,(H,25,31)(H,26,35)(H,36,37,38) |
| InChIKey | ONAYJZPQUCYNGH-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 193.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.62 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|