C24H33N5O10S2 — CID 57050058
(2S,3R)-2-methoxycarbonyl-3-[[2-[(4-octyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-thiophen-2-ylacetyl]amino]-4-oxoazetidine-1-sulfonic acid (PubChem CID 57050058) has the molecular formula C24H33N5O10S2 and a molecular weight of 615.69 g/mol. Its IUPAC name is (2S,3R)-2-methoxycarbonyl-3-[[2-[(4-octyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-thiophen-2-ylacetyl]amino]-4-oxoazetidine-1-sulfonic acid.
| Compound Name | (2S,3R)-2-methoxycarbonyl-3-[[2-[(4-octyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-thiophen-2-ylacetyl]amino]-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 57050058 |
| Molecular Formula | C24H33N5O10S2 |
| Molecular Weight | 615.69 g/mol |
| Exact Mass | 615.17 |
| IUPAC Name | (2S,3R)-2-methoxycarbonyl-3-[[2-[(4-octyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-thiophen-2-ylacetyl]amino]-4-oxoazetidine-1-sulfonic acid |
| SMILES | CCCCCCCCN1CCN(C(=O)NC(C(=O)N[C@H]2C(=O)N(S(=O)(=O)O)[C@@H]2C(=O)OC)c2cccs2)C(=O)C1=O |
| InChI | InChI=1S/C24H33N5O10S2/c1-3-4-5-6-7-8-11-27-12-13-28(22(33)21(27)32)24(35)26-16(15-10-9-14-40-15)19(30)25-17-18(23(34)39-2)29(20(17)31)41(36,37)38/h9-10,14,16-18H,3-8,11-13H2,1-2H3,(H,25,30)(H,26,35)(H,36,37,38)/t16?,17-,18+/m1/s1 |
| InChIKey | RUSAINFKUMTMSV-RWZMTBSZSA-N |
| XLogP | 0.20 |
| TPSA | 199.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.69 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|