C28H32N6O7S2 — CID 70378569
benzyl (2S,5R,6R)-6-amino-6-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-thiophen-2-ylacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 70378569) has the molecular formula C28H32N6O7S2 and a molecular weight of 628.73 g/mol. Its IUPAC name is benzyl (2S,5R,6R)-6-amino-6-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-thiophen-2-ylacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzyl (2S,5R,6R)-6-amino-6-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-thiophen-2-ylacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 70378569 |
| Molecular Formula | C28H32N6O7S2 |
| Molecular Weight | 628.73 g/mol |
| Exact Mass | 628.18 |
| IUPAC Name | benzyl (2S,5R,6R)-6-amino-6-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-thiophen-2-ylacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CCN1CCN(C(=O)NC(C(=O)N[C@]2(N)C(=O)N3[C@@H](C(=O)OCc4ccccc4)C(C)(C)S[C@@H]32)c2cccs2)C(=O)C1=O |
| InChI | InChI=1S/C28H32N6O7S2/c1-4-32-12-13-33(22(37)21(32)36)26(40)30-18(17-11-8-14-42-17)20(35)31-28(29)24(39)34-19(27(2,3)43-25(28)34)23(38)41-15-16-9-6-5-7-10-16/h5-11,14,18-19,25H,4,12-13,15,29H2,1-3H3,(H,30,40)(H,31,35)/t18?,19-,25+,28+/m0/s1 |
| InChIKey | KJOSLJUPHXQVEM-WLTLVXGESA-N |
| XLogP | 0.77 |
| TPSA | 171.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.73 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|