C16H19N5O8S2 — CID 12834627
3-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-thiophen-2-ylacetyl]amino]-2-oxoazetidine-1-sulfonic acid (PubChem CID 12834627) has the molecular formula C16H19N5O8S2 and a molecular weight of 473.49 g/mol. Its IUPAC name is 3-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-thiophen-2-ylacetyl]amino]-2-oxoazetidine-1-sulfonic acid.
| Compound Name | 3-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-thiophen-2-ylacetyl]amino]-2-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 12834627 |
| Molecular Formula | C16H19N5O8S2 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | 3-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-thiophen-2-ylacetyl]amino]-2-oxoazetidine-1-sulfonic acid |
| SMILES | CCN1CCN(C(=O)NC(C(=O)NC2CN(S(=O)(=O)O)C2=O)c2cccs2)C(=O)C1=O |
| InChI | InChI=1S/C16H19N5O8S2/c1-2-19-5-6-20(15(25)14(19)24)16(26)18-11(10-4-3-7-30-10)12(22)17-9-8-21(13(9)23)31(27,28)29/h3-4,7,9,11H,2,5-6,8H2,1H3,(H,17,22)(H,18,26)(H,27,28,29) |
| InChIKey | NSDYEPNUJIDPKE-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 173.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|