C18H26N6O11S — CID 70391847
3-[[4-[(2-ethoxy-2-oxoethyl)amino]-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-4-oxobutanoyl]amino]-2-oxoazetidine-1-sulfonic acid (PubChem CID 70391847) has the molecular formula C18H26N6O11S and a molecular weight of 534.50 g/mol. Its IUPAC name is 3-[[4-[(2-ethoxy-2-oxoethyl)amino]-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-4-oxobutanoyl]amino]-2-oxoazetidine-1-sulfonic acid.
| Compound Name | 3-[[4-[(2-ethoxy-2-oxoethyl)amino]-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-4-oxobutanoyl]amino]-2-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 70391847 |
| Molecular Formula | C18H26N6O11S |
| Molecular Weight | 534.50 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | 3-[[4-[(2-ethoxy-2-oxoethyl)amino]-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-4-oxobutanoyl]amino]-2-oxoazetidine-1-sulfonic acid |
| SMILES | CCOC(=O)CNC(=O)CC(NC(=O)N1CCN(CC)C(=O)C1=O)C(=O)NC1CN(S(=O)(=O)O)C1=O |
| InChI | InChI=1S/C18H26N6O11S/c1-3-22-5-6-23(17(30)16(22)29)18(31)21-10(7-12(25)19-8-13(26)35-4-2)14(27)20-11-9-24(15(11)28)36(32,33)34/h10-11H,3-9H2,1-2H3,(H,19,25)(H,20,27)(H,21,31)(H,32,33,34) |
| InChIKey | BFMIIDOIZHGNLZ-UHFFFAOYSA-N |
| XLogP | -4.05 |
| TPSA | 228.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.50 |
| LogP ≤ 5 | -4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|