C15H22N6O9S — CID 70391652
3-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-4-(methylamino)-4-oxobutanoyl]amino]-2-oxoazetidine-1-sulfonic acid (PubChem CID 70391652) has the molecular formula C15H22N6O9S and a molecular weight of 462.44 g/mol. Its IUPAC name is 3-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-4-(methylamino)-4-oxobutanoyl]amino]-2-oxoazetidine-1-sulfonic acid.
| Compound Name | 3-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-4-(methylamino)-4-oxobutanoyl]amino]-2-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 70391652 |
| Molecular Formula | C15H22N6O9S |
| Molecular Weight | 462.44 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 3-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-4-(methylamino)-4-oxobutanoyl]amino]-2-oxoazetidine-1-sulfonic acid |
| SMILES | CCN1CCN(C(=O)NC(CC(=O)NC)C(=O)NC2CN(S(=O)(=O)O)C2=O)C(=O)C1=O |
| InChI | InChI=1S/C15H22N6O9S/c1-3-19-4-5-20(14(26)13(19)25)15(27)18-8(6-10(22)16-2)11(23)17-9-7-21(12(9)24)31(28,29)30/h8-9H,3-7H2,1-2H3,(H,16,22)(H,17,23)(H,18,27)(H,28,29,30) |
| InChIKey | RQIUNOBQBUFERG-UHFFFAOYSA-N |
| XLogP | -3.98 |
| TPSA | 202.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.44 |
| LogP ≤ 5 | -3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|