C10H14N4O7S — CID 70392301
3-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonic acid (PubChem CID 70392301) has the molecular formula C10H14N4O7S and a molecular weight of 334.31 g/mol. Its IUPAC name is 3-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonic acid.
| Compound Name | 3-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 70392301 |
| Molecular Formula | C10H14N4O7S |
| Molecular Weight | 334.31 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 3-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonic acid |
| SMILES | CCN1CCN(C(=O)NC2CN(S(=O)(=O)O)C2=O)C(=O)C1=O |
| InChI | InChI=1S/C10H14N4O7S/c1-2-12-3-4-13(9(17)8(12)16)10(18)11-6-5-14(7(6)15)22(19,20)21/h6H,2-5H2,1H3,(H,11,18)(H,19,20,21) |
| InChIKey | UMLZPHMRCZBPRG-UHFFFAOYSA-N |
| XLogP | -2.60 |
| TPSA | 144.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.31 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|