C13H18N5NaO8S — CID 161390981
sodium 3-[[(2R)-2-aminopropanoyl]-(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonate (PubChem CID 161390981) has the molecular formula C13H18N5NaO8S and a molecular weight of 427.37 g/mol. Its IUPAC name is sodium 3-[[(2R)-2-aminopropanoyl]-(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonate.
| Compound Name | sodium 3-[[(2R)-2-aminopropanoyl]-(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonate |
|---|---|
| PubChem CID | 161390981 |
| Molecular Formula | C13H18N5NaO8S |
| Molecular Weight | 427.37 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | sodium 3-[[(2R)-2-aminopropanoyl]-(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonate |
| SMILES | CCN1CCN(C(=O)N(C(=O)[C@@H](C)N)C2CN(S(=O)(=O)[O-])C2=O)C(=O)C1=O.[Na+] |
| InChI | InChI=1S/C13H19N5O8S.Na/c1-3-15-4-5-16(12(22)11(15)21)13(23)18(9(19)7(2)14)8-6-17(10(8)20)27(24,25)26;/h7-8H,3-6,14H2,1-2H3,(H,24,25,26);/q;+1/p-1/t7-,8?;/m1./s1 |
| InChIKey | VSZFPGRUGCXUNA-PGMKYVDRSA-M |
| XLogP | -6.35 |
| TPSA | 181.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.37 |
| LogP ≤ 5 | -6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|