C15H17N8NaO8S — CID 159691013
sodium (2S,3S)-2-azido-3-[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]pent-4-ynoylamino]-4-oxoazetidine-1-sulfonate (PubChem CID 159691013) has the molecular formula C15H17N8NaO8S and a molecular weight of 492.41 g/mol. Its IUPAC name is sodium (2S,3S)-2-azido-3-[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]pent-4-ynoylamino]-4-oxoazetidine-1-sulfonate.
| Compound Name | sodium (2S,3S)-2-azido-3-[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]pent-4-ynoylamino]-4-oxoazetidine-1-sulfonate |
|---|---|
| PubChem CID | 159691013 |
| Molecular Formula | C15H17N8NaO8S |
| Molecular Weight | 492.41 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | sodium (2S,3S)-2-azido-3-[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]pent-4-ynoylamino]-4-oxoazetidine-1-sulfonate |
| SMILES | C#CCC(NC(=O)N1CCN(CC)C(=O)C1=O)C(=O)N[C@@H]1C(=O)N(S(=O)(=O)[O-])[C@@H]1N=[N+]=[N-].[Na+] |
| InChI | InChI=1S/C15H18N8O8S.Na/c1-3-5-8(17-15(28)22-7-6-21(4-2)13(26)14(22)27)11(24)18-9-10(19-20-16)23(12(9)25)32(29,30)31;/h1,8-10H,4-7H2,2H3,(H,17,28)(H,18,24)(H,29,30,31);/q;+1/p-1/t8?,9-,10-;/m0./s1 |
| InChIKey | MWKIFTQUIPWFMV-KMQXGVQRSA-M |
| XLogP | -5.79 |
| TPSA | 225.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.41 |
| LogP ≤ 5 | -5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|