C15H22N5NaO8S2 — CID 159211434
sodium 3-[[(2R)-2-amino-4-methylsulfanylbutanoyl]-(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonate (PubChem CID 159211434) has the molecular formula C15H22N5NaO8S2 and a molecular weight of 487.49 g/mol. Its IUPAC name is sodium 3-[[(2R)-2-amino-4-methylsulfanylbutanoyl]-(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonate.
| Compound Name | sodium 3-[[(2R)-2-amino-4-methylsulfanylbutanoyl]-(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonate |
|---|---|
| PubChem CID | 159211434 |
| Molecular Formula | C15H22N5NaO8S2 |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | sodium 3-[[(2R)-2-amino-4-methylsulfanylbutanoyl]-(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonate |
| SMILES | CCN1CCN(C(=O)N(C(=O)[C@H](N)CCSC)C2CN(S(=O)(=O)[O-])C2=O)C(=O)C1=O.[Na+] |
| InChI | InChI=1S/C15H23N5O8S2.Na/c1-3-17-5-6-18(14(24)13(17)23)15(25)20(11(21)9(16)4-7-29-2)10-8-19(12(10)22)30(26,27)28;/h9-10H,3-8,16H2,1-2H3,(H,26,27,28);/q;+1/p-1/t9-,10?;/m1./s1 |
| InChIKey | KQNRKTRRBFOTNX-UVUXOWFKSA-M |
| XLogP | -5.62 |
| TPSA | 181.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | -5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|