C15H21N9O8S2 — CID 88773776
3-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-3-(5-methyltetrazol-5-yl)sulfanylpropanoyl]amino]-2-oxoazetidine-1-sulfonic acid (PubChem CID 88773776) has the molecular formula C15H21N9O8S2 and a molecular weight of 519.52 g/mol. Its IUPAC name is 3-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-3-(5-methyltetrazol-5-yl)sulfanylpropanoyl]amino]-2-oxoazetidine-1-sulfonic acid.
| Compound Name | 3-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-3-(5-methyltetrazol-5-yl)sulfanylpropanoyl]amino]-2-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 88773776 |
| Molecular Formula | C15H21N9O8S2 |
| Molecular Weight | 519.52 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | 3-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-3-(5-methyltetrazol-5-yl)sulfanylpropanoyl]amino]-2-oxoazetidine-1-sulfonic acid |
| SMILES | CCN1CCN(C(=O)NC(CSC2(C)N=NN=N2)C(=O)NC2CN(S(=O)(=O)O)C2=O)C(=O)C1=O |
| InChI | InChI=1S/C15H21N9O8S2/c1-3-22-4-5-23(13(28)12(22)27)14(29)17-9(7-33-15(2)18-20-21-19-15)10(25)16-8-6-24(11(8)26)34(30,31)32/h8-9H,3-7H2,1-2H3,(H,16,25)(H,17,29)(H,30,31,32) |
| InChIKey | PBXIKDKBUOILAB-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 222.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.52 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|