C15H23N5O8S2 — CID 159211435
3-[[(2R)-2-amino-4-methylsulfanylbutanoyl]-(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonic acid (PubChem CID 159211435) has the molecular formula C15H23N5O8S2 and a molecular weight of 465.51 g/mol. Its IUPAC name is 3-[[(2R)-2-amino-4-methylsulfanylbutanoyl]-(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonic acid.
| Compound Name | 3-[[(2R)-2-amino-4-methylsulfanylbutanoyl]-(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 159211435 |
| Molecular Formula | C15H23N5O8S2 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 3-[[(2R)-2-amino-4-methylsulfanylbutanoyl]-(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonic acid |
| SMILES | CCN1CCN(C(=O)N(C(=O)[C@H](N)CCSC)C2CN(S(=O)(=O)O)C2=O)C(=O)C1=O |
| InChI | InChI=1S/C15H23N5O8S2/c1-3-17-5-6-18(14(24)13(17)23)15(25)20(11(21)9(16)4-7-29-2)10-8-19(12(10)22)30(26,27)28/h9-10H,3-8,16H2,1-2H3,(H,26,27,28)/t9-,10?/m1/s1 |
| InChIKey | HBJCXZPFKWZOBX-YHMJZVADSA-N |
| XLogP | -2.28 |
| TPSA | 178.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|