C13H19N5O8S — CID 161390982
3-[[(2R)-2-aminopropanoyl]-(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonic acid (PubChem CID 161390982) has the molecular formula C13H19N5O8S and a molecular weight of 405.39 g/mol. Its IUPAC name is 3-[[(2R)-2-aminopropanoyl]-(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonic acid.
| Compound Name | 3-[[(2R)-2-aminopropanoyl]-(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 161390982 |
| Molecular Formula | C13H19N5O8S |
| Molecular Weight | 405.39 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 3-[[(2R)-2-aminopropanoyl]-(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-oxoazetidine-1-sulfonic acid |
| SMILES | CCN1CCN(C(=O)N(C(=O)[C@@H](C)N)C2CN(S(=O)(=O)O)C2=O)C(=O)C1=O |
| InChI | InChI=1S/C13H19N5O8S/c1-3-15-4-5-16(12(22)11(15)21)13(23)18(9(19)7(2)14)8-6-17(10(8)20)27(24,25)26/h7-8H,3-6,14H2,1-2H3,(H,24,25,26)/t7-,8?/m1/s1 |
| InChIKey | SHAUIZVAZMTBFU-GVHYBUMESA-N |
| XLogP | -3.01 |
| TPSA | 178.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.39 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|