C22H26N6O8S2 — CID 56619080
(2S,5R,6R)-2-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-thiophen-2-ylacetyl]amino]-6-formamido-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 56619080) has the molecular formula C22H26N6O8S2 and a molecular weight of 566.62 g/mol. Its IUPAC name is (2S,5R,6R)-2-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-thiophen-2-ylacetyl]amino]-6-formamido-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6R)-2-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-thiophen-2-ylacetyl]amino]-6-formamido-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 56619080 |
| Molecular Formula | C22H26N6O8S2 |
| Molecular Weight | 566.62 g/mol |
| Exact Mass | 566.13 |
| IUPAC Name | (2S,5R,6R)-2-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-thiophen-2-ylacetyl]amino]-6-formamido-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CCN1CCN(C(=O)NC(C(=O)N[C@@]2(C(=O)O)N3C(=O)[C@@H](NC=O)[C@H]3SC2(C)C)c2cccs2)C(=O)C1=O |
| InChI | InChI=1S/C22H26N6O8S2/c1-4-26-7-8-27(17(33)16(26)32)20(36)24-12(11-6-5-9-37-11)14(30)25-22(19(34)35)21(2,3)38-18-13(23-10-29)15(31)28(18)22/h5-6,9-10,12-13,18H,4,7-8H2,1-3H3,(H,23,29)(H,24,36)(H,25,30)(H,34,35)/t12?,13-,18-,22+/m1/s1 |
| InChIKey | LDSQIJSHXGPSNO-HVRQKGSXSA-N |
| XLogP | -1.11 |
| TPSA | 185.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.62 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|