C31H34N6O9S — CID 88643820
benzyl (2S,5R,6R)-2-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl]amino]-6-formamido-3,3-dimethyl-4,7-dioxo-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 88643820) has the molecular formula C31H34N6O9S and a molecular weight of 666.71 g/mol. Its IUPAC name is benzyl (2S,5R,6R)-2-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl]amino]-6-formamido-3,3-dimethyl-4,7-dioxo-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzyl (2S,5R,6R)-2-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl]amino]-6-formamido-3,3-dimethyl-4,7-dioxo-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 88643820 |
| Molecular Formula | C31H34N6O9S |
| Molecular Weight | 666.71 g/mol |
| Exact Mass | 666.21 |
| IUPAC Name | benzyl (2S,5R,6R)-2-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl]amino]-6-formamido-3,3-dimethyl-4,7-dioxo-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CCN1CCN(C(=O)NC(C(=O)N[C@@]2(C(=O)OCc3ccccc3)N3C(=O)[C@@H](NC=O)[C@H]3S(=O)C2(C)C)c2ccccc2)C(=O)C1=O |
| InChI | InChI=1S/C31H34N6O9S/c1-4-35-15-16-36(26(42)25(35)41)29(44)33-21(20-13-9-6-10-14-20)23(39)34-31(28(43)46-17-19-11-7-5-8-12-19)30(2,3)47(45)27-22(32-18-38)24(40)37(27)31/h5-14,18,21-22,27H,4,15-17H2,1-3H3,(H,32,38)(H,33,44)(H,34,39)/t21?,22-,27-,31+,47?/m1/s1 |
| InChIKey | XRQGYEXCDUYFQY-PBFXOJHDSA-N |
| XLogP | -0.49 |
| TPSA | 191.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.71 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|