C15H22N5NaO7S2 — CID 88629053
sodium (2R,3R)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-(pentylamino)acetyl]amino]-2-methoxycarbonyl-4-oxoazetidine-1-sulfonate (PubChem CID 88629053) has the molecular formula C15H22N5NaO7S2 and a molecular weight of 471.49 g/mol. Its IUPAC name is sodium (2R,3R)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-(pentylamino)acetyl]amino]-2-methoxycarbonyl-4-oxoazetidine-1-sulfonate.
| Compound Name | sodium (2R,3R)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-(pentylamino)acetyl]amino]-2-methoxycarbonyl-4-oxoazetidine-1-sulfonate |
|---|---|
| PubChem CID | 88629053 |
| Molecular Formula | C15H22N5NaO7S2 |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | sodium (2R,3R)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-(pentylamino)acetyl]amino]-2-methoxycarbonyl-4-oxoazetidine-1-sulfonate |
| SMILES | CCCCCNC(C(=O)N[C@H]1C(=O)N(S(=O)(=O)[O-])[C@H]1C(=O)OC)c1csc(N)n1.[Na+] |
| InChI | InChI=1S/C15H23N5O7S2.Na/c1-3-4-5-6-17-9(8-7-28-15(16)18-8)12(21)19-10-11(14(23)27-2)20(13(10)22)29(24,25)26;/h7,9-11,17H,3-6H2,1-2H3,(H2,16,18)(H,19,21)(H,24,25,26);/q;+1/p-1/t9?,10-,11-;/m1./s1 |
| InChIKey | ZSERCKKFODDXLM-DKDCRDSBSA-M |
| XLogP | -4.12 |
| TPSA | 183.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | -4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|