C13H16N3NaO7S2 — CID 70392266
sodium 3-[[2-(dimethylsulfamoyl)-2-phenylacetyl]amino]-2-oxoazetidine-1-sulfonate (PubChem CID 70392266) has the molecular formula C13H16N3NaO7S2 and a molecular weight of 413.41 g/mol. Its IUPAC name is sodium 3-[[2-(dimethylsulfamoyl)-2-phenylacetyl]amino]-2-oxoazetidine-1-sulfonate.
| Compound Name | sodium 3-[[2-(dimethylsulfamoyl)-2-phenylacetyl]amino]-2-oxoazetidine-1-sulfonate |
|---|---|
| PubChem CID | 70392266 |
| Molecular Formula | C13H16N3NaO7S2 |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | sodium 3-[[2-(dimethylsulfamoyl)-2-phenylacetyl]amino]-2-oxoazetidine-1-sulfonate |
| SMILES | CN(C)S(=O)(=O)C(C(=O)NC1CN(S(=O)(=O)[O-])C1=O)c1ccccc1.[Na+] |
| InChI | InChI=1S/C13H17N3O7S2.Na/c1-15(2)24(19,20)11(9-6-4-3-5-7-9)12(17)14-10-8-16(13(10)18)25(21,22)23;/h3-7,10-11H,8H2,1-2H3,(H,14,17)(H,21,22,23);/q;+1/p-1 |
| InChIKey | YUTCRWDBGBFMTM-UHFFFAOYSA-M |
| XLogP | -4.59 |
| TPSA | 143.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | -4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|