C23H18F3N4NaO7S — CID 158237676
sodium 2-oxo-3-[[(2R)-2-[[4-oxo-7-(2,2,2-trifluoroethyl)-1H-quinoline-3-carbonyl]amino]-2-phenylacetyl]amino]azetidine-1-sulfonate (PubChem CID 158237676) has the molecular formula C23H18F3N4NaO7S and a molecular weight of 574.47 g/mol. Its IUPAC name is sodium 2-oxo-3-[[(2R)-2-[[4-oxo-7-(2,2,2-trifluoroethyl)-1H-quinoline-3-carbonyl]amino]-2-phenylacetyl]amino]azetidine-1-sulfonate.
| Compound Name | sodium 2-oxo-3-[[(2R)-2-[[4-oxo-7-(2,2,2-trifluoroethyl)-1H-quinoline-3-carbonyl]amino]-2-phenylacetyl]amino]azetidine-1-sulfonate |
|---|---|
| PubChem CID | 158237676 |
| Molecular Formula | C23H18F3N4NaO7S |
| Molecular Weight | 574.47 g/mol |
| Exact Mass | 574.07 |
| IUPAC Name | sodium 2-oxo-3-[[(2R)-2-[[4-oxo-7-(2,2,2-trifluoroethyl)-1H-quinoline-3-carbonyl]amino]-2-phenylacetyl]amino]azetidine-1-sulfonate |
| SMILES | O=C(N[C@@H](C(=O)NC1CN(S(=O)(=O)[O-])C1=O)c1ccccc1)c1c[nH]c2cc(CC(F)(F)F)ccc2c1=O.[Na+] |
| InChI | InChI=1S/C23H19F3N4O7S.Na/c24-23(25,26)9-12-6-7-14-16(8-12)27-10-15(19(14)31)20(32)29-18(13-4-2-1-3-5-13)21(33)28-17-11-30(22(17)34)38(35,36)37;/h1-8,10,17-18H,9,11H2,(H,27,31)(H,28,33)(H,29,32)(H,35,36,37);/q;+1/p-1/t17?,18-;/m1./s1 |
| InChIKey | GFDXZYBKCJWVJR-MVFUPKDGSA-M |
| XLogP | -2.10 |
| TPSA | 168.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.47 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|