C19H17Cl2N3O6S2 — CID 158650599
3-[[(2R)-2-[[2-(2,6-dichlorophenyl)-2-sulfanylacetyl]amino]-2-phenylacetyl]amino]-2-oxoazetidine-1-sulfonic acid (PubChem CID 158650599) has the molecular formula C19H17Cl2N3O6S2 and a molecular weight of 518.40 g/mol. Its IUPAC name is 3-[[(2R)-2-[[2-(2,6-dichlorophenyl)-2-sulfanylacetyl]amino]-2-phenylacetyl]amino]-2-oxoazetidine-1-sulfonic acid.
| Compound Name | 3-[[(2R)-2-[[2-(2,6-dichlorophenyl)-2-sulfanylacetyl]amino]-2-phenylacetyl]amino]-2-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 158650599 |
| Molecular Formula | C19H17Cl2N3O6S2 |
| Molecular Weight | 518.40 g/mol |
| Exact Mass | 516.99 |
| IUPAC Name | 3-[[(2R)-2-[[2-(2,6-dichlorophenyl)-2-sulfanylacetyl]amino]-2-phenylacetyl]amino]-2-oxoazetidine-1-sulfonic acid |
| SMILES | O=C(N[C@@H](C(=O)NC1CN(S(=O)(=O)O)C1=O)c1ccccc1)C(S)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H17Cl2N3O6S2/c20-11-7-4-8-12(21)14(11)16(31)18(26)23-15(10-5-2-1-3-6-10)17(25)22-13-9-24(19(13)27)32(28,29)30/h1-8,13,15-16,31H,9H2,(H,22,25)(H,23,26)(H,28,29,30)/t13?,15-,16?/m1/s1 |
| InChIKey | XWWABLBNGAFZQA-OGVSOVDVSA-N |
| XLogP | 1.95 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|