C12H14N2O8S2 — CID 23317260
2-oxo-2-[[2-oxo-1-(sulfomethyl)azetidin-3-yl]amino]-1-phenylethanesulfonic acid (PubChem CID 23317260) has the molecular formula C12H14N2O8S2 and a molecular weight of 378.38 g/mol. Its IUPAC name is 2-oxo-2-[[2-oxo-1-(sulfomethyl)azetidin-3-yl]amino]-1-phenylethanesulfonic acid.
| Compound Name | 2-oxo-2-[[2-oxo-1-(sulfomethyl)azetidin-3-yl]amino]-1-phenylethanesulfonic acid |
|---|---|
| PubChem CID | 23317260 |
| Molecular Formula | C12H14N2O8S2 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | 2-oxo-2-[[2-oxo-1-(sulfomethyl)azetidin-3-yl]amino]-1-phenylethanesulfonic acid |
| SMILES | O=C(NC1CN(CS(=O)(=O)O)C1=O)C(c1ccccc1)S(=O)(=O)O |
| InChI | InChI=1S/C12H14N2O8S2/c15-11(10(24(20,21)22)8-4-2-1-3-5-8)13-9-6-14(12(9)16)7-23(17,18)19/h1-5,9-10H,6-7H2,(H,13,15)(H,17,18,19)(H,20,21,22) |
| InChIKey | NFQUMPAOFFFPBJ-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|